initial commit

admin/services/paypal/node/advanced-integration/.env

@@ -0,0 +1,2 @@
+CLIENT_ID=AbehsBM-Cg5UwIx6pAWObkiltltLPwN82QlhN-u4qwYMD7Fzly_mDmUGYnSJqHuMLIWjhBk9I5iKsvIN
+APP_SECRET=EIMOBpKnMGNlgaofARDgpuigkvpoSilNUJQSXSmXhNRwxrVosOVp1DCpb7Ky2OfjX7rR0SqszgRMyg1-

admin/services/paypal/node/advanced-integration/README.md

@@ -0,0 +1,9 @@
+# Advanced Integration Example
+
+## Instructions
+
+1. Add `CLIENT_ID` and `APP_SECRET` to the `.env` file
+2. Run `npm install`
+3. Run `npm start`
+4. Open http://localhost:8888
+5. Enter the credit card number provided from one of your [sandbox accounts](https://developer.paypal.com/dashboard/accounts) or [generate a new credit card](https://developer.paypal.com/dashboard/creditCardGenerator)

admin/services/paypal/node/advanced-integration/package-lock.json

@@ -0,0 +1,971 @@
+{
+  "name": "@paypalcorp/advanced-integration",
+  "version": "1.0.0",
+  "lockfileVersion": 3,
+  "requires": true,
+  "packages": {
+    "": {
+      "name": "@paypalcorp/advanced-integration",
+      "version": "1.0.0",
+      "license": "Apache-2.0",
+      "dependencies": {
+        "dotenv": "^16.0.0",
+        "ejs": "^3.1.6",
+        "express": "^4.17.3",
+        "html-entities": "^2.4.0",
+        "mysql2": "^3.6.0",
+        "node-fetch": "^3.2.1"
+      }
+    },
+    "node_modules/accepts": {
+      "version": "1.3.8",
+      "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz",
+      "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==",
+      "dependencies": {
+        "mime-types": "~2.1.34",
+        "negotiator": "0.6.3"
+      },
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/ansi-styles": {
+      "version": "4.3.0",
+      "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz",
+      "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==",
+      "dependencies": {
+        "color-convert": "^2.0.1"
+      },
+      "engines": {
+        "node": ">=8"
+      },
+      "funding": {
+        "url": "https://github.com/chalk/ansi-styles?sponsor=1"
+      }
+    },
+    "node_modules/array-flatten": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+      "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg=="
+    },
+    "node_modules/async": {
+      "version": "3.2.4",
+      "resolved": "https://registry.npmjs.org/async/-/async-3.2.4.tgz",
+      "integrity": "sha512-iAB+JbDEGXhyIUavoDl9WP/Jj106Kz9DEn1DPgYw5ruDn0e3Wgi3sKFm55sASdGBNOQB8F59d9qQ7deqrHA8wQ=="
+    },
+    "node_modules/balanced-match": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz",
+      "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw=="
+    },
+    "node_modules/body-parser": {
+      "version": "1.20.1",
+      "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.1.tgz",
+      "integrity": "sha512-jWi7abTbYwajOytWCQc37VulmWiRae5RyTpaCyDcS5/lMdtwSz5lOpDE67srw/HYe35f1z3fDQw+3txg7gNtWw==",
+      "dependencies": {
+        "bytes": "3.1.2",
+        "content-type": "~1.0.4",
+        "debug": "2.6.9",
+        "depd": "2.0.0",
+        "destroy": "1.2.0",
+        "http-errors": "2.0.0",
+        "iconv-lite": "0.4.24",
+        "on-finished": "2.4.1",
+        "qs": "6.11.0",
+        "raw-body": "2.5.1",
+        "type-is": "~1.6.18",
+        "unpipe": "1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.8",
+        "npm": "1.2.8000 || >= 1.4.16"
+      }
+    },
+    "node_modules/brace-expansion": {
+      "version": "1.1.11",
+      "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
+      "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
+      "dependencies": {
+        "balanced-match": "^1.0.0",
+        "concat-map": "0.0.1"
+      }
+    },
+    "node_modules/bytes": {
+      "version": "3.1.2",
+      "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz",
+      "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==",
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/call-bind": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.2.tgz",
+      "integrity": "sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA==",
+      "dependencies": {
+        "function-bind": "^1.1.1",
+        "get-intrinsic": "^1.0.2"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/chalk": {
+      "version": "4.1.2",
+      "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz",
+      "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==",
+      "dependencies": {
+        "ansi-styles": "^4.1.0",
+        "supports-color": "^7.1.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/chalk/chalk?sponsor=1"
+      }
+    },
+    "node_modules/color-convert": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz",
+      "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==",
+      "dependencies": {
+        "color-name": "~1.1.4"
+      },
+      "engines": {
+        "node": ">=7.0.0"
+      }
+    },
+    "node_modules/color-name": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz",
+      "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA=="
+    },
+    "node_modules/concat-map": {
+      "version": "0.0.1",
+      "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
+      "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg=="
+    },
+    "node_modules/content-disposition": {
+      "version": "0.5.4",
+      "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz",
+      "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==",
+      "dependencies": {
+        "safe-buffer": "5.2.1"
+      },
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/content-type": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz",
+      "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/cookie": {
+      "version": "0.5.0",
+      "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.5.0.tgz",
+      "integrity": "sha512-YZ3GUyn/o8gfKJlnlX7g7xq4gyO6OSuhGPKaaGssGB2qgDUS0gPgtTvoyZLTt9Ab6dC4hfc9dV5arkvc/OCmrw==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/cookie-signature": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+      "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ=="
+    },
+    "node_modules/data-uri-to-buffer": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/data-uri-to-buffer/-/data-uri-to-buffer-4.0.1.tgz",
+      "integrity": "sha512-0R9ikRb668HB7QDxT1vkpuUBtqc53YyAwMwGeUFKRojY/NWKvdZ+9UYtRfGmhqNbRkTSVpMbmyhXipFFv2cb/A==",
+      "engines": {
+        "node": ">= 12"
+      }
+    },
+    "node_modules/debug": {
+      "version": "2.6.9",
+      "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+      "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+      "dependencies": {
+        "ms": "2.0.0"
+      }
+    },
+    "node_modules/denque": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/denque/-/denque-2.1.0.tgz",
+      "integrity": "sha512-HVQE3AAb/pxF8fQAoiqpvg9i3evqug3hoiwakOyZAwJm+6vZehbkYXZ0l4JxS+I3QxM97v5aaRNhj8v5oBhekw==",
+      "engines": {
+        "node": ">=0.10"
+      }
+    },
+    "node_modules/depd": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz",
+      "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==",
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/destroy": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz",
+      "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==",
+      "engines": {
+        "node": ">= 0.8",
+        "npm": "1.2.8000 || >= 1.4.16"
+      }
+    },
+    "node_modules/dotenv": {
+      "version": "16.3.1",
+      "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-16.3.1.tgz",
+      "integrity": "sha512-IPzF4w4/Rd94bA9imS68tZBaYyBWSCE47V1RGuMrB94iyTOIEwRmVL2x/4An+6mETpLrKJ5hQkB8W4kFAadeIQ==",
+      "engines": {
+        "node": ">=12"
+      },
+      "funding": {
+        "url": "https://github.com/motdotla/dotenv?sponsor=1"
+      }
+    },
+    "node_modules/ee-first": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+      "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow=="
+    },
+    "node_modules/ejs": {
+      "version": "3.1.9",
+      "resolved": "https://registry.npmjs.org/ejs/-/ejs-3.1.9.tgz",
+      "integrity": "sha512-rC+QVNMJWv+MtPgkt0y+0rVEIdbtxVADApW9JXrUVlzHetgcyczP/E7DJmWJ4fJCZF2cPcBk0laWO9ZHMG3DmQ==",
+      "dependencies": {
+        "jake": "^10.8.5"
+      },
+      "bin": {
+        "ejs": "bin/cli.js"
+      },
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/encodeurl": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+      "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==",
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/escape-html": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+      "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow=="
+    },
+    "node_modules/etag": {
+      "version": "1.8.1",
+      "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+      "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/express": {
+      "version": "4.18.2",
+      "resolved": "https://registry.npmjs.org/express/-/express-4.18.2.tgz",
+      "integrity": "sha512-5/PsL6iGPdfQ/lKM1UuielYgv3BUoJfz1aUwU9vHZ+J7gyvwdQXFEBIEIaxeGf0GIcreATNyBExtalisDbuMqQ==",
+      "dependencies": {
+        "accepts": "~1.3.8",
+        "array-flatten": "1.1.1",
+        "body-parser": "1.20.1",
+        "content-disposition": "0.5.4",
+        "content-type": "~1.0.4",
+        "cookie": "0.5.0",
+        "cookie-signature": "1.0.6",
+        "debug": "2.6.9",
+        "depd": "2.0.0",
+        "encodeurl": "~1.0.2",
+        "escape-html": "~1.0.3",
+        "etag": "~1.8.1",
+        "finalhandler": "1.2.0",
+        "fresh": "0.5.2",
+        "http-errors": "2.0.0",
+        "merge-descriptors": "1.0.1",
+        "methods": "~1.1.2",
+        "on-finished": "2.4.1",
+        "parseurl": "~1.3.3",
+        "path-to-regexp": "0.1.7",
+        "proxy-addr": "~2.0.7",
+        "qs": "6.11.0",
+        "range-parser": "~1.2.1",
+        "safe-buffer": "5.2.1",
+        "send": "0.18.0",
+        "serve-static": "1.15.0",
+        "setprototypeof": "1.2.0",
+        "statuses": "2.0.1",
+        "type-is": "~1.6.18",
+        "utils-merge": "1.0.1",
+        "vary": "~1.1.2"
+      },
+      "engines": {
+        "node": ">= 0.10.0"
+      }
+    },
+    "node_modules/fetch-blob": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/fetch-blob/-/fetch-blob-3.2.0.tgz",
+      "integrity": "sha512-7yAQpD2UMJzLi1Dqv7qFYnPbaPx7ZfFK6PiIxQ4PfkGPyNyl2Ugx+a/umUonmKqjhM4DnfbMvdX6otXq83soQQ==",
+      "funding": [
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/jimmywarting"
+        },
+        {
+          "type": "paypal",
+          "url": "https://paypal.me/jimmywarting"
+        }
+      ],
+      "dependencies": {
+        "node-domexception": "^1.0.0",
+        "web-streams-polyfill": "^3.0.3"
+      },
+      "engines": {
+        "node": "^12.20 || >= 14.13"
+      }
+    },
+    "node_modules/filelist": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/filelist/-/filelist-1.0.4.tgz",
+      "integrity": "sha512-w1cEuf3S+DrLCQL7ET6kz+gmlJdbq9J7yXCSjK/OZCPA+qEN1WyF4ZAf0YYJa4/shHJra2t/d/r8SV4Ji+x+8Q==",
+      "dependencies": {
+        "minimatch": "^5.0.1"
+      }
+    },
+    "node_modules/filelist/node_modules/brace-expansion": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-2.0.1.tgz",
+      "integrity": "sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==",
+      "dependencies": {
+        "balanced-match": "^1.0.0"
+      }
+    },
+    "node_modules/filelist/node_modules/minimatch": {
+      "version": "5.1.6",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-5.1.6.tgz",
+      "integrity": "sha512-lKwV/1brpG6mBUFHtb7NUmtABCb2WZZmm2wNiOA5hAb8VdCS4B3dtMWyvcoViccwAW/COERjXLt0zP1zXUN26g==",
+      "dependencies": {
+        "brace-expansion": "^2.0.1"
+      },
+      "engines": {
+        "node": ">=10"
+      }
+    },
+    "node_modules/finalhandler": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.2.0.tgz",
+      "integrity": "sha512-5uXcUVftlQMFnWC9qu/svkWv3GTd2PfUhK/3PLkYNAe7FbqJMt3515HaxE6eRL74GdsriiwujiawdaB1BpEISg==",
+      "dependencies": {
+        "debug": "2.6.9",
+        "encodeurl": "~1.0.2",
+        "escape-html": "~1.0.3",
+        "on-finished": "2.4.1",
+        "parseurl": "~1.3.3",
+        "statuses": "2.0.1",
+        "unpipe": "~1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/formdata-polyfill": {
+      "version": "4.0.10",
+      "resolved": "https://registry.npmjs.org/formdata-polyfill/-/formdata-polyfill-4.0.10.tgz",
+      "integrity": "sha512-buewHzMvYL29jdeQTVILecSaZKnt/RJWjoZCF5OW60Z67/GmSLBkOFM7qh1PI3zFNtJbaZL5eQu1vLfazOwj4g==",
+      "dependencies": {
+        "fetch-blob": "^3.1.2"
+      },
+      "engines": {
+        "node": ">=12.20.0"
+      }
+    },
+    "node_modules/forwarded": {
+      "version": "0.2.0",
+      "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz",
+      "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/fresh": {
+      "version": "0.5.2",
+      "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz",
+      "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/function-bind": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz",
+      "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A=="
+    },
+    "node_modules/generate-function": {
+      "version": "2.3.1",
+      "resolved": "https://registry.npmjs.org/generate-function/-/generate-function-2.3.1.tgz",
+      "integrity": "sha512-eeB5GfMNeevm/GRYq20ShmsaGcmI81kIX2K9XQx5miC8KdHaC6Jm0qQ8ZNeGOi7wYB8OsdxKs+Y2oVuTFuVwKQ==",
+      "dependencies": {
+        "is-property": "^1.0.2"
+      }
+    },
+    "node_modules/get-intrinsic": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.1.tgz",
+      "integrity": "sha512-2DcsyfABl+gVHEfCOaTrWgyt+tb6MSEGmKq+kI5HwLbIYgjgmMcV8KQ41uaKz1xxUcn9tJtgFbQUEVcEbd0FYw==",
+      "dependencies": {
+        "function-bind": "^1.1.1",
+        "has": "^1.0.3",
+        "has-proto": "^1.0.1",
+        "has-symbols": "^1.0.3"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/has": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz",
+      "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==",
+      "dependencies": {
+        "function-bind": "^1.1.1"
+      },
+      "engines": {
+        "node": ">= 0.4.0"
+      }
+    },
+    "node_modules/has-flag": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz",
+      "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==",
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/has-proto": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.1.tgz",
+      "integrity": "sha512-7qE+iP+O+bgF9clE5+UoBFzE65mlBiVj3tKCrlNQ0Ogwm0BjpT/gK4SlLYDMybDh5I3TCTKnPPa0oMG7JDYrhg==",
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/has-symbols": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz",
+      "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==",
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/html-entities": {
+      "version": "2.4.0",
+      "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-2.4.0.tgz",
+      "integrity": "sha512-igBTJcNNNhvZFRtm8uA6xMY6xYleeDwn3PeBCkDz7tHttv4F2hsDI2aPgNERWzvRcNYHNT3ymRaQzllmXj4YsQ==",
+      "funding": [
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/mdevils"
+        },
+        {
+          "type": "patreon",
+          "url": "https://patreon.com/mdevils"
+        }
+      ]
+    },
+    "node_modules/http-errors": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz",
+      "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==",
+      "dependencies": {
+        "depd": "2.0.0",
+        "inherits": "2.0.4",
+        "setprototypeof": "1.2.0",
+        "statuses": "2.0.1",
+        "toidentifier": "1.0.1"
+      },
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/iconv-lite": {
+      "version": "0.4.24",
+      "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz",
+      "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==",
+      "dependencies": {
+        "safer-buffer": ">= 2.1.2 < 3"
+      },
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/inherits": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+      "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ=="
+    },
+    "node_modules/ipaddr.js": {
+      "version": "1.9.1",
+      "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz",
+      "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==",
+      "engines": {
+        "node": ">= 0.10"
+      }
+    },
+    "node_modules/is-property": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/is-property/-/is-property-1.0.2.tgz",
+      "integrity": "sha512-Ks/IoX00TtClbGQr4TWXemAnktAQvYB7HzcCxDGqEZU6oCmb2INHuOoKxbtR+HFkmYWBKv/dOZtGRiAjDhj92g=="
+    },
+    "node_modules/jake": {
+      "version": "10.8.7",
+      "resolved": "https://registry.npmjs.org/jake/-/jake-10.8.7.tgz",
+      "integrity": "sha512-ZDi3aP+fG/LchyBzUM804VjddnwfSfsdeYkwt8NcbKRvo4rFkjhs456iLFn3k2ZUWvNe4i48WACDbza8fhq2+w==",
+      "dependencies": {
+        "async": "^3.2.3",
+        "chalk": "^4.0.2",
+        "filelist": "^1.0.4",
+        "minimatch": "^3.1.2"
+      },
+      "bin": {
+        "jake": "bin/cli.js"
+      },
+      "engines": {
+        "node": ">=10"
+      }
+    },
+    "node_modules/long": {
+      "version": "5.2.3",
+      "resolved": "https://registry.npmjs.org/long/-/long-5.2.3.tgz",
+      "integrity": "sha512-lcHwpNoggQTObv5apGNCTdJrO69eHOZMi4BNC+rTLER8iHAqGrUVeLh/irVIM7zTw2bOXA8T6uNPeujwOLg/2Q=="
+    },
+    "node_modules/lru-cache": {
+      "version": "8.0.5",
+      "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-8.0.5.tgz",
+      "integrity": "sha512-MhWWlVnuab1RG5/zMRRcVGXZLCXrZTgfwMikgzCegsPnG62yDQo5JnqKkrK4jO5iKqDAZGItAqN5CtKBCBWRUA==",
+      "engines": {
+        "node": ">=16.14"
+      }
+    },
+    "node_modules/media-typer": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
+      "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/merge-descriptors": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz",
+      "integrity": "sha512-cCi6g3/Zr1iqQi6ySbseM1Xvooa98N0w31jzUYrXPX2xqObmFGHJ0tQ5u74H3mVh7wLouTseZyYIq39g8cNp1w=="
+    },
+    "node_modules/methods": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz",
+      "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/mime": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz",
+      "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==",
+      "bin": {
+        "mime": "cli.js"
+      },
+      "engines": {
+        "node": ">=4"
+      }
+    },
+    "node_modules/mime-db": {
+      "version": "1.52.0",
+      "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz",
+      "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/mime-types": {
+      "version": "2.1.35",
+      "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz",
+      "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==",
+      "dependencies": {
+        "mime-db": "1.52.0"
+      },
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/minimatch": {
+      "version": "3.1.2",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz",
+      "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==",
+      "dependencies": {
+        "brace-expansion": "^1.1.7"
+      },
+      "engines": {
+        "node": "*"
+      }
+    },
+    "node_modules/ms": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+      "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A=="
+    },
+    "node_modules/mysql2": {
+      "version": "3.6.0",
+      "resolved": "https://registry.npmjs.org/mysql2/-/mysql2-3.6.0.tgz",
+      "integrity": "sha512-EWUGAhv6SphezurlfI2Fpt0uJEWLmirrtQR7SkbTHFC+4/mJBrPiSzHESHKAWKG7ALVD6xaG/NBjjd1DGJGQQQ==",
+      "dependencies": {
+        "denque": "^2.1.0",
+        "generate-function": "^2.3.1",
+        "iconv-lite": "^0.6.3",
+        "long": "^5.2.1",
+        "lru-cache": "^8.0.0",
+        "named-placeholders": "^1.1.3",
+        "seq-queue": "^0.0.5",
+        "sqlstring": "^2.3.2"
+      },
+      "engines": {
+        "node": ">= 8.0"
+      }
+    },
+    "node_modules/mysql2/node_modules/iconv-lite": {
+      "version": "0.6.3",
+      "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.3.tgz",
+      "integrity": "sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw==",
+      "dependencies": {
+        "safer-buffer": ">= 2.1.2 < 3.0.0"
+      },
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/mysql2/node_modules/sqlstring": {
+      "version": "2.3.3",
+      "resolved": "https://registry.npmjs.org/sqlstring/-/sqlstring-2.3.3.tgz",
+      "integrity": "sha512-qC9iz2FlN7DQl3+wjwn3802RTyjCx7sDvfQEXchwa6CWOx07/WVfh91gBmQ9fahw8snwGEWU3xGzOt4tFyHLxg==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/named-placeholders": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/named-placeholders/-/named-placeholders-1.1.3.tgz",
+      "integrity": "sha512-eLoBxg6wE/rZkJPhU/xRX1WTpkFEwDJEN96oxFrTsqBdbT5ec295Q+CoHrL9IT0DipqKhmGcaZmwOt8OON5x1w==",
+      "dependencies": {
+        "lru-cache": "^7.14.1"
+      },
+      "engines": {
+        "node": ">=12.0.0"
+      }
+    },
+    "node_modules/named-placeholders/node_modules/lru-cache": {
+      "version": "7.18.3",
+      "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-7.18.3.tgz",
+      "integrity": "sha512-jumlc0BIUrS3qJGgIkWZsyfAM7NCWiBcCDhnd+3NNM5KbBmLTgHVfWBcg6W+rLUsIpzpERPsvwUP7CckAQSOoA==",
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/negotiator": {
+      "version": "0.6.3",
+      "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz",
+      "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/node-domexception": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/node-domexception/-/node-domexception-1.0.0.tgz",
+      "integrity": "sha512-/jKZoMpw0F8GRwl4/eLROPA3cfcXtLApP0QzLmUT/HuPCZWyB7IY9ZrMeKw2O/nFIqPQB3PVM9aYm0F312AXDQ==",
+      "funding": [
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/jimmywarting"
+        },
+        {
+          "type": "github",
+          "url": "https://paypal.me/jimmywarting"
+        }
+      ],
+      "engines": {
+        "node": ">=10.5.0"
+      }
+    },
+    "node_modules/node-fetch": {
+      "version": "3.3.2",
+      "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-3.3.2.tgz",
+      "integrity": "sha512-dRB78srN/l6gqWulah9SrxeYnxeddIG30+GOqK/9OlLVyLg3HPnr6SqOWTWOXKRwC2eGYCkZ59NNuSgvSrpgOA==",
+      "dependencies": {
+        "data-uri-to-buffer": "^4.0.0",
+        "fetch-blob": "^3.1.4",
+        "formdata-polyfill": "^4.0.10"
+      },
+      "engines": {
+        "node": "^12.20.0 || ^14.13.1 || >=16.0.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/node-fetch"
+      }
+    },
+    "node_modules/object-inspect": {
+      "version": "1.12.3",
+      "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.12.3.tgz",
+      "integrity": "sha512-geUvdk7c+eizMNUDkRpW1wJwgfOiOeHbxBR/hLXK1aT6zmVSO0jsQcs7fj6MGw89jC/cjGfLcNOrtMYtGqm81g==",
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/on-finished": {
+      "version": "2.4.1",
+      "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz",
+      "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==",
+      "dependencies": {
+        "ee-first": "1.1.1"
+      },
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/parseurl": {
+      "version": "1.3.3",
+      "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz",
+      "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==",
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/path-to-regexp": {
+      "version": "0.1.7",
+      "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz",
+      "integrity": "sha512-5DFkuoqlv1uYQKxy8omFBeJPQcdoE07Kv2sferDCrAq1ohOU+MSDswDIbnx3YAM60qIOnYa53wBhXW0EbMonrQ=="
+    },
+    "node_modules/proxy-addr": {
+      "version": "2.0.7",
+      "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz",
+      "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==",
+      "dependencies": {
+        "forwarded": "0.2.0",
+        "ipaddr.js": "1.9.1"
+      },
+      "engines": {
+        "node": ">= 0.10"
+      }
+    },
+    "node_modules/qs": {
+      "version": "6.11.0",
+      "resolved": "https://registry.npmjs.org/qs/-/qs-6.11.0.tgz",
+      "integrity": "sha512-MvjoMCJwEarSbUYk5O+nmoSzSutSsTwF85zcHPQ9OrlFoZOYIjaqBAJIqIXjptyD5vThxGq52Xu/MaJzRkIk4Q==",
+      "dependencies": {
+        "side-channel": "^1.0.4"
+      },
+      "engines": {
+        "node": ">=0.6"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/range-parser": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz",
+      "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/raw-body": {
+      "version": "2.5.1",
+      "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.1.tgz",
+      "integrity": "sha512-qqJBtEyVgS0ZmPGdCFPWJ3FreoqvG4MVQln/kCgF7Olq95IbOp0/BWyMwbdtn4VTvkM8Y7khCQ2Xgk/tcrCXig==",
+      "dependencies": {
+        "bytes": "3.1.2",
+        "http-errors": "2.0.0",
+        "iconv-lite": "0.4.24",
+        "unpipe": "1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/safe-buffer": {
+      "version": "5.2.1",
+      "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz",
+      "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==",
+      "funding": [
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/feross"
+        },
+        {
+          "type": "patreon",
+          "url": "https://www.patreon.com/feross"
+        },
+        {
+          "type": "consulting",
+          "url": "https://feross.org/support"
+        }
+      ]
+    },
+    "node_modules/safer-buffer": {
+      "version": "2.1.2",
+      "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
+      "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg=="
+    },
+    "node_modules/send": {
+      "version": "0.18.0",
+      "resolved": "https://registry.npmjs.org/send/-/send-0.18.0.tgz",
+      "integrity": "sha512-qqWzuOjSFOuqPjFe4NOsMLafToQQwBSOEpS+FwEt3A2V3vKubTquT3vmLTQpFgMXp8AlFWFuP1qKaJZOtPpVXg==",
+      "dependencies": {
+        "debug": "2.6.9",
+        "depd": "2.0.0",
+        "destroy": "1.2.0",
+        "encodeurl": "~1.0.2",
+        "escape-html": "~1.0.3",
+        "etag": "~1.8.1",
+        "fresh": "0.5.2",
+        "http-errors": "2.0.0",
+        "mime": "1.6.0",
+        "ms": "2.1.3",
+        "on-finished": "2.4.1",
+        "range-parser": "~1.2.1",
+        "statuses": "2.0.1"
+      },
+      "engines": {
+        "node": ">= 0.8.0"
+      }
+    },
+    "node_modules/send/node_modules/ms": {
+      "version": "2.1.3",
+      "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+      "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA=="
+    },
+    "node_modules/seq-queue": {
+      "version": "0.0.5",
+      "resolved": "https://registry.npmjs.org/seq-queue/-/seq-queue-0.0.5.tgz",
+      "integrity": "sha512-hr3Wtp/GZIc/6DAGPDcV4/9WoZhjrkXsi5B/07QgX8tsdc6ilr7BFM6PM6rbdAX1kFSDYeZGLipIZZKyQP0O5Q=="
+    },
+    "node_modules/serve-static": {
+      "version": "1.15.0",
+      "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.15.0.tgz",
+      "integrity": "sha512-XGuRDNjXUijsUL0vl6nSD7cwURuzEgglbOaFuZM9g3kwDXOWVTck0jLzjPzGD+TazWbboZYu52/9/XPdUgne9g==",
+      "dependencies": {
+        "encodeurl": "~1.0.2",
+        "escape-html": "~1.0.3",
+        "parseurl": "~1.3.3",
+        "send": "0.18.0"
+      },
+      "engines": {
+        "node": ">= 0.8.0"
+      }
+    },
+    "node_modules/setprototypeof": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz",
+      "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw=="
+    },
+    "node_modules/side-channel": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.4.tgz",
+      "integrity": "sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw==",
+      "dependencies": {
+        "call-bind": "^1.0.0",
+        "get-intrinsic": "^1.0.2",
+        "object-inspect": "^1.9.0"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/statuses": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz",
+      "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==",
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/supports-color": {
+      "version": "7.2.0",
+      "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz",
+      "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==",
+      "dependencies": {
+        "has-flag": "^4.0.0"
+      },
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/toidentifier": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz",
+      "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==",
+      "engines": {
+        "node": ">=0.6"
+      }
+    },
+    "node_modules/type-is": {
+      "version": "1.6.18",
+      "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz",
+      "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==",
+      "dependencies": {
+        "media-typer": "0.3.0",
+        "mime-types": "~2.1.24"
+      },
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/unpipe": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz",
+      "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==",
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/utils-merge": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz",
+      "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==",
+      "engines": {
+        "node": ">= 0.4.0"
+      }
+    },
+    "node_modules/vary": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz",
+      "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==",
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/web-streams-polyfill": {
+      "version": "3.2.1",
+      "resolved": "https://registry.npmjs.org/web-streams-polyfill/-/web-streams-polyfill-3.2.1.tgz",
+      "integrity": "sha512-e0MO3wdXWKrLbL0DgGnUV7WHVuw9OUvL4hjgnPkIeEvESk74gAITi5G606JtZPp39cd8HA9VQzCIvA49LpPN5Q==",
+      "engines": {
+        "node": ">= 8"
+      }
+    }
+  }
+}

admin/services/paypal/node/advanced-integration/package.json

@@ -0,0 +1,22 @@
+{
+  "name": "@paypalcorp/advanced-integration",
+  "version": "1.0.0",
+  "description": "",
+  "main": "server.js",
+  "type": "module",
+  "scripts": {
+    "test": "echo \"Error: no test specified\" && exit 1",
+    "start": "node server.js",
+    "start2": "node server2.js"
+  },
+  "author": "",
+  "license": "Apache-2.0",
+  "dependencies": {
+    "dotenv": "^16.0.0",
+    "ejs": "^3.1.6",
+    "express": "^4.17.3",
+    "html-entities": "^2.4.0",
+    "mysql2": "^3.6.0",
+    "node-fetch": "^3.2.1"
+  }
+}

admin/services/paypal/node/advanced-integration/paypal-api.js

@@ -0,0 +1,380 @@
+import fetch from "node-fetch";
+
+// set some important variables
+// const { CLIENT_ID, APP_SECRET } = process.env;
+// const base = "https://api-m.sandbox.paypal.com"; 
+
+
+async function handleResponse(response) {
+	if (response.status === 200 || response.status === 201) {
+	  return response.json();
+	}
+  
+	const errorMessage = await response.text();
+	throw new Error(errorMessage);
+}
+
+// generate access token
+export async function generateAccessToken(base,PaypalClientId,PaypalAppSecret) {
+	console.log(PaypalClientId + ":" + PaypalAppSecret);
+	const auth = Buffer.from(PaypalClientId + ":" + PaypalAppSecret).toString("base64");
+	console.log(auth);
+	const response = await fetch(`${base}/v1/oauth2/token`, {
+	  method: "post",
+	  body: "grant_type=client_credentials",
+	  headers: {
+		Authorization: `Basic ${auth}`,
+	  },
+	});
+	const jsonData = await handleResponse(response);
+	return jsonData.access_token;
+}
+  
+// generate client token
+export async function generateClientToken(base,PaypalClientId,PaypalAppSecret) {
+const accessToken = await generateAccessToken(base, PaypalClientId,PaypalAppSecret);
+const response = await fetch(`${base}/v1/identity/generate-token`, {
+	method: "post",
+	headers: {
+	Authorization: `Bearer ${accessToken}`,
+	"Accept-Language": "en_US",
+	"Content-Type": "application/json",
+	},
+});
+console.log('response', response.status)
+const jsonData = await handleResponse(response);
+return jsonData.client_token;
+}
+
+// call the create order method
+export async function createOrder(base,data,PaypalClientId,PaypalAppSecret) {  
+  const purchaseAmount = data.price;//"100.00"; // TODO: pull prices from a database 
+  const accessToken = await generateAccessToken(base,PaypalClientId,PaypalAppSecret);
+  const url = `${base}/v2/checkout/orders`;
+  console.log(url)
+  const response = await fetch(url, {
+    method: "post",
+    headers: {
+      "Content-Type": "application/json",
+      Authorization: `Bearer ${accessToken}`,
+    },
+    body: JSON.stringify({
+      intent: "CAPTURE",
+      purchase_units: [
+        {
+          amount: {
+            currency_code: "USD",
+            value: purchaseAmount,
+          },
+        },
+      ],
+    }),
+  });
+
+  return handleResponse(response);
+}
+
+// capture payment for an order
+export async function capturePayment(base,orderId,PaypalClientId,PaypalAppSecret) {
+  const accessToken = await generateAccessToken(base,PaypalClientId,PaypalAppSecret);
+  const url = `${base}/v2/checkout/orders/${orderId}/capture`;
+  const response = await fetch(url, {
+    method: "post",
+    headers: {
+      "Content-Type": "application/json",
+      Authorization: `Bearer ${accessToken}`,
+    },
+  });
+
+  return handleResponse(response);
+}
+
+
+export async function verifyWebHook(base,PaypalClientId,PaypalAppSecret){
+	const accessToken = await generateAccessToken(base,PaypalClientId,PaypalAppSecret);
+	const url = `${base}/v1/notifications/verify-webhook-signature`;
+	// fetch('https://api-m.sandbox.paypal.com/v1/notifications/verify-webhook-signature', {
+	const response = await fetch(url, {
+		method: 'POST',
+		headers: {
+			'Content-Type': 'application/json',
+			Authorization: `Bearer ${accessToken}`,
+		},
+		body: JSON.stringify({ 
+			"transmission_id": "69cd13f0-d67a-11e5-baa3-778b53f4ae55", 
+			"transmission_time": "2016-02-18T20:01:35Z", 
+			"cert_url": "cert_url",       // PAYPAL-CERT-URL
+			"auth_algo": "SHA256withRSA", // PAYPAL-AUTH-ALGO
+			"transmission_sig": "lmI95Jx3Y9nhR5SJWlHVIWpg4AgFk7n9bCHSRxbrd8A9zrhdu2rMyFrmz+Zjh3s3boXB07VXCXUZy/UFzUlnGJn0wDugt7FlSvdKeIJenLRemUxYCPVoEZzg9VFNqOa48gMkvF+XTpxBeUx/kWy6B5cp7GkT2+pOowfRK7OaynuxUoKW3JcMWw272VKjLTtTAShncla7tGF+55rxyt2KNZIIqxNMJ48RDZheGU5w1npu9dZHnPgTXB9iomeVRoD8O/jhRpnKsGrDschyNdkeh81BJJMH4Ctc6lnCCquoP/GzCzz33MMsNdid7vL/NIWaCsekQpW26FpWPi/tfj8nLA==", 
+			"webhook_id": "1JE4291016473214C", 
+			"webhook_event": { 
+				"id": "8PT597110X687430LKGECATA", 
+				"create_time": "2013-06-25T21:41:28Z", 
+				"resource_type": "authorization", 
+				"event_type": "PAYMENT.AUTHORIZATION.CREATED", 
+				"summary": "A payment authorization was created", 
+				"resource": { 
+					"id": "2DC87612EK520411B", 
+					"create_time": "2013-06-25T21:39:15Z", 
+					"update_time": "2013-06-25T21:39:17Z", 
+					"state": "authorized", 
+					"amount": { 
+						"total": "7.47", 
+						"currency": "USD", 
+						"details": { 
+							"subtotal": "7.47" 
+						} 
+					}, 
+					"parent_payment": "PAY-36246664YD343335CKHFA4AY", 
+					"valid_until": "2013-07-24T21:39:15Z", "links": [ 
+						{ 
+							"href": "https://api-m.paypal.com/v1/payments/authorization/2DC87612EK520411B", 
+							"rel": "self", 
+							"method": "GET" 
+						}, 
+						{ 
+							"href": "https://api-m.paypal.com/v1/payments/authorization/2DC87612EK520411B/capture",
+						 	"rel": "capture", 
+						 	"method": "POST" 
+						}, 
+						{ 
+							"href": "https://api-m.paypal.com/v1/payments/authorization/2DC87612EK520411B/void", 
+							"rel": "void", 
+							"method": "POST" 
+						}, 
+						{
+							"href": "https://api-m.paypal.com/v1/payments/payment/PAY-36246664YD343335CKHFA4AY", 
+							"rel": "parent_payment", 
+							"method": "GET" 
+						} 
+					] 
+				} 
+			} 
+		})// end body
+	});// end fetch
+	if (response.status === 200 || response.status === 201) {
+		return response.json();
+	}
+	
+	const errorMessage = await response.text();
+	throw new Error(errorMessage);
+}
+
+export async function payout(base,PaypalClientId,PaypalAppSecret,data){
+	const accessToken = await generateAccessToken(base,PaypalClientId,PaypalAppSecret);
+	const url = `${base}/v1/payments/payouts`;
+
+	const response = await fetch(url, {
+		method: 'POST',
+		headers: {
+			'Content-Type': 'application/json',
+			'Authorization': `Bearer ${accessToken}`
+		},
+		body: data
+	});
+	return handleResponse(response);
+}
+
+// capture payment for an order
+export async function refundPayment(base,PaypalClientId,PaypalAppSecret,orderId) { 
+  const accessToken = await generateAccessToken(base, PaypalClientId,PaypalAppSecret);
+  const url = `${base}/v2/payments/captures/${capture_id}/refund`;
+  const response = await fetch(url, {
+    method: "post",
+    headers: {
+      "Content-Type": "application/json",
+      "Authorization": `Bearer ${accessToken}`,
+      'PayPal-Request-Id': '123e4567-e89b-12d3-a456-426655440020',
+      'Prefer': 'return=representation'
+    },
+    body: JSON.stringify(
+      { 
+        "amount": { "value": "10.00", "currency_code": "USD" }, 
+        "invoice_id": "INVOICE-123", 
+        "note_to_payer": "DefectiveProduct", 
+        "payment_instruction": { 
+            "platform_fees": [ 
+              { 
+                "amount": { 
+                  "currency_code": "USD", 
+                  "value": "1.00" 
+                } 
+              } 
+            ] 
+        } 
+      })
+  });
+
+  return handleResponse(response);
+}
+
+
+export async function create_subscription_product(base,PaypalClientId,PaypalAppSecret,data){
+	const accessToken = await generateAccessToken(base,PaypalClientId,PaypalAppSecret);
+	const url = `${base}/v1/catalogs/products`;
+
+	// let data = {
+	// 	"consumer": {
+	// 		"accountNumber":1181198218909172527,
+	// 		"merchantId":"5KW8F2FXKX5HA"
+	// 	},
+	// 	"merchant":{
+	// 		"accountNumber":1659371090107732880,
+	// 		"merchantId":"2J6QB8YJQSJRJ"
+	// 	},
+	// 	"apiCaller":{
+	// 		"clientId":"AdtlNBDhgmQWi2xk6edqJVKklPFyDWxtyKuXuyVT-OgdnnKpAVsbKHgvqHHP",
+	// 		"appId":"APP-6DV794347V142302B",
+	// 		"payerId":"2J6QB8YJQSJRJ",
+	// 		"accountNumber":"1659371090107732880"
+	// 	},
+	// 	"scopes":["https://api-m.paypal.com/v1/subscription/.*","https://uri.paypal.com/services/subscription","openid"]
+	// }
+
+	const response = await fetch(url, {
+	//fetch('https://api-m.sandbox.paypal.com/v1/catalogs/products', {
+		method: 'POST',
+		headers: {  
+			// 'X-PAYPAL-SECURITY-CONTEXT': '{"consumer":{"accountNumber":1181198218909172527,"merchantId":"5KW8F2FXKX5HA"},"merchant":{"accountNumber":1659371090107732880,"merchantId":"2J6QB8YJQSJRJ"},"apiCaller":{"clientId":"AdtlNBDhgmQWi2xk6edqJVKklPFyDWxtyKuXuyVT-OgdnnKpAVsbKHgvqHHP","appId":"APP-6DV794347V142302B","payerId":"2J6QB8YJQSJRJ","accountNumber":"1659371090107732880"},"scopes":["https://api-m.paypal.com/v1/subscription/.*","https://uri.paypal.com/services/subscription","openid"]}',
+			'X-PAYPAL-SECURITY-CONTEXT': JSON.stringify(data),
+			'Content-Type': 'application/json',
+			'Accept': 'application/json',
+			'PayPal-Request-Id': 'PRODUCT-18062019-001',
+			'Prefer': 'return=representation'
+		},
+		body: JSON.stringify({ 
+			"name": "Video Streaming Service", 
+			"description": "Video streaming service", 
+			"type": "SERVICE", 
+			"category": "SOFTWARE", 
+			"image_url": "https://example.com/streaming.jpg", 
+			"home_url": "https://example.com/home" 
+		})
+	});
+
+
+	return handleResponse(response);
+}
+export async function create_subscription_plan(base,PaypalClientId,PaypalAppSecret,data){
+	const accessToken = await generateAccessToken(base,PaypalClientId,PaypalAppSecret);
+	const url = `${base}/v1/billing/plans`;
+	// let data = {
+	// 	"consumer":{
+	// 		"accountNumber":1181198218909172527,
+	// 		"merchantId":"5KW8F2FXKX5HA"
+	// 	},
+	// 	"merchant":{
+	// 		"accountNumber":1659371090107732880,
+	// 		"merchantId":"2J6QB8YJQSJRJ"
+	// 	},
+	// 	"apiCaller":{
+	// 		"clientId":"AdtlNBDhgmQWi2xk6edqJVKklPFyDWxtyKuXuyVT-OgdnnKpAVsbKHgvqHHP",
+	// 		"appId":"APP-6DV794347V142302B",
+	// 		"payerId":"2J6QB8YJQSJRJ",
+	// 		"accountNumber":"1659371090107732880"
+	// 	},
+	// 	"scopes":["https://api-m.paypal.com/v1/subscription/.*","https://uri.paypal.com/services/subscription","openid"]
+	// };
+
+	const response = await fetch(url, {
+		// fetch('https://api-m.sandbox.paypal.com/v1/billing/plans', {
+			method: 'POST',
+			headers: {
+				'X-PAYPAL-SECURITY-CONTEXT': JSON.stringify(data),
+				'Content-Type': 'application/json',
+				'Accept': 'application/json',
+				'PayPal-Request-Id': 'PLAN-18062019-001',
+				'Prefer': 'return=representation'
+			},
+			body: JSON.stringify({ 
+				"product_id": "PROD-XXCD1234QWER65782", 
+				"name": "Video Streaming Service Plan", 
+				"description": "Video Streaming Service basic plan", 
+				"status": "ACTIVE", 
+				"billing_cycles": [ 
+					{ 
+						"frequency": { 
+							"interval_unit": "MONTH",
+							"interval_count": 1 
+						}, 
+						"tenure_type": "TRIAL", 
+						"sequence": 1, 
+						"total_cycles": 2,
+						"pricing_scheme": { 
+							"fixed_price": { 
+								"value": "3", 
+								"currency_code": "USD" 
+							} 
+						} 
+					}, 
+					{ 
+						"frequency": { 
+							"interval_unit": "MONTH", 
+							"interval_count": 1 
+						},
+						"tenure_type": "TRIAL", 
+						"sequence": 2, 
+						"total_cycles": 3, 
+						"pricing_scheme": { 
+							"fixed_price": { 
+								"value": "6", 
+								"currency_code": "USD" 
+							} 
+						} 
+					}, 
+					{ 
+						"frequency": { 
+							"interval_unit": "MONTH", 
+							"interval_count": 1 
+						}, 
+						"tenure_type": "REGULAR", 
+						"sequence": 3, 
+						"total_cycles": 12, 
+						"pricing_scheme": { 
+							"fixed_price": { 
+								"value": "10", 
+								"currency_code": 
+								"USD" 
+							} 
+						} 
+					} 
+				], 
+				"payment_preferences": { 
+					"auto_bill_outstanding": true, 
+					"setup_fee": { 
+						"value": "10", 
+						"currency_code": "USD" 
+					}, "setup_fee_failure_action": "CONTINUE", 
+					"payment_failure_threshold": 3 
+				}, 
+				"taxes": { 
+					"percentage": "10", 
+					"inclusive": false 
+				} 
+			})
+		});
+		
+
+
+	return handleResponse(response);
+}
+
+export async function get_product_plan(base,PaypalClientId,PaypalAppSecret,data){
+	const accessToken = await generateAccessToken(base,PaypalClientId,PaypalAppSecret);
+	const url = `${base}/v1/catalogs/products?page_size=2&page=1&total_required=true`;
+
+
+	const response = await fetch(url, {
+	// fetch('https://api-m.sandbox.paypal.com/v1/catalogs/products?page_size=2&page=1&total_required=true', {
+		headers: {
+			'X-PAYPAL-SECURITY-CONTEXT': JSON.stringify(data),
+			'Content-Type': 'application/json',
+			'Accept': 'application/json',
+			"Authorization": `Bearer ${accessToken}`,
+		}
+	});
+
+
+	return handleResponse(response);
+}
+

admin/services/paypal/node/advanced-integration/public/app.js

@@ -0,0 +1,160 @@
+paypal
+  .Buttons({
+    // Sets up the transaction when a payment button is clicked
+    createOrder: function () {
+      return fetch("/api/orders", {
+        method: "post",
+        // use the "body" param to optionally pass additional order information
+        // like product skus and quantities
+        body: JSON.stringify({
+          cart: [
+            {
+              sku: "<YOUR_PRODUCT_STOCK_KEEPING_UNIT>",
+              quantity: "<YOUR_PRODUCT_QUANTITY>",
+            },
+          ],
+        }),
+      })
+        .then((response) => response.json())
+        .then((order) => order.id);
+    },
+    // Finalize the transaction after payer approval
+    onApprove: function (data) {
+      return fetch(`/api/orders/${data.orderID}/capture`, { 
+        method: "post",
+      })
+        .then((response) => response.json())
+        .then((orderData) => {
+          // Successful capture! For dev/demo purposes:
+          console.log(
+            "Capture result",
+            orderData,
+            JSON.stringify(orderData, null, 2)
+          );
+          const transaction = orderData.purchase_units[0].payments.captures[0];
+          alert(`Transaction ${transaction.status}: ${transaction.id}
+
+            See console for all available details
+          `);
+          // When ready to go live, remove the alert and show a success message within this page. For example:
+          // var element = document.getElementById('paypal-button-container');
+          // element.innerHTML = '<h3>Thank you for your payment!</h3>';
+          // Or go to another URL:  actions.redirect('thank_you.html');
+        });
+    },
+  })
+  .render("#paypal-button-container");
+
+// If this returns false or the card fields aren't visible, see Step #1.
+if (paypal.HostedFields.isEligible()) {
+  let orderId;
+
+  // Renders card fields
+  paypal.HostedFields.render({
+    // Call your server to set up the transaction
+    createOrder: () => {
+      return fetch("/api/orders", {
+        method: "post",
+        // use the "body" param to optionally pass additional order information
+        // like product skus and quantities
+        body: JSON.stringify({
+          cart: [
+            {
+              sku: "<YOUR_PRODUCT_STOCK_KEEPING_UNIT>",
+              quantity: "<YOUR_PRODUCT_QUANTITY>",
+            },
+          ],
+        }),
+      })
+        .then((res) => res.json())
+        .then((orderData) => {
+          orderId = orderData.id; // needed later to complete capture
+          return orderData.id;
+        });
+    },
+    styles: {
+      ".valid": {
+        color: "green",
+      },
+      ".invalid": {
+        color: "red",
+      },
+    },
+    fields: {
+      number: {
+        selector: "#card-number",
+        placeholder: "4111 1111 1111 1111",
+      },
+      cvv: {
+        selector: "#cvv",
+        placeholder: "123",
+      },
+      expirationDate: {
+        selector: "#expiration-date",
+        placeholder: "MM/YY",
+      },
+    },
+  }).then((cardFields) => {
+    document.querySelector("#card-form").addEventListener("submit", (event) => {
+      event.preventDefault();
+      cardFields
+        .submit({
+          // Cardholder's first and last name
+          cardholderName: document.getElementById("card-holder-name").value,
+          // Billing Address
+          billingAddress: {
+            // Street address, line 1
+            streetAddress: document.getElementById(
+              "card-billing-address-street"
+            ).value,
+            // Street address, line 2 (Ex: Unit, Apartment, etc.)
+            extendedAddress: document.getElementById(
+              "card-billing-address-unit"
+            ).value,
+            // State
+            region: document.getElementById("card-billing-address-state").value,
+            // City
+            locality: document.getElementById("card-billing-address-city")
+              .value,
+            // Postal Code
+            postalCode: document.getElementById("card-billing-address-zip")
+              .value,
+            // Country Code
+            countryCodeAlpha2: document.getElementById(
+              "card-billing-address-country"
+            ).value,
+          },
+        })
+        .then(() => {
+          fetch(`/api/orders/${orderId}/capture`, {
+            method: "post",
+          })
+            .then((res) => res.json())
+            .then((orderData) => {
+              // Two cases to handle:
+              //   (1) Other non-recoverable errors -> Show a failure message
+              //   (2) Successful transaction -> Show confirmation or thank you
+              // This example reads a v2/checkout/orders capture response, propagated from the server
+              // You could use a different API or structure for your 'orderData'
+              const errorDetail =
+                Array.isArray(orderData.details) && orderData.details[0];
+              if (errorDetail) {
+                var msg = "Sorry, your transaction could not be processed.";
+                if (errorDetail.description)
+                  msg += "\n\n" + errorDetail.description;
+                if (orderData.debug_id) msg += " (" + orderData.debug_id + ")";
+                return alert(msg); // Show a failure message
+              }
+              // Show a success message or redirect
+              alert("Transaction completed!");
+            });
+        })
+        .catch((err) => {
+          alert("Payment could not be captured! " + JSON.stringify(err));
+        });
+    });
+  });
+} else {
+  // Hides card fields if the merchant isn't eligible
+  document.querySelector("#card-form").style = "display: none";
+}

admin/services/paypal/node/advanced-integration/server.js

@@ -0,0 +1,257 @@
+import { createRequire } from 'module';
+import path from 'path'; 
+import { fileURLToPath } from 'url';
+const require = createRequire(import.meta.url);
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = path.dirname(__filename);
+const fs = require('fs');
+import {decode} from 'html-entities';
+//import "dotenv/config";
+import express from "express";
+import http from "http";  
+import https from "https";  
+import * as paypal from "./paypal-api.js";   
+var mysql = require('mysql2');
+
+// pm2 start server.js --name "www5" -- www5
+// pm2 start server.js --name "www10" -- www10
+// pm2 delete www15;pm2 start server.js --name www15 -- www15;pm2 logs www --lines 1000
+// pm2 logs --lines 1000
+// /home/cradle2careertxxyz/websites/www10/portal/dashboard/system/scripts
+// /home/cradle2careertxxyz/websites/www10/portal/dashboard/services/paypal/node/advanced-integration
+
+//process.argv.forEach(function (val, index, array) {console.log(index + ': ' + val);});
+const subdomain = process.argv[2];
+const mypath = path.join(__dirname, '../../../../../system/db/.env');
+require('dotenv').config({ path: mypath })
+
+console.log(process.env.MY_DATABASE);
+console.log(mypath);
+console.log(subdomain);
+
+function createMySQLConnection(){
+    return mysql.createConnection({  
+        host: process.env.MY_HOSTNAME,
+        user: process.env.MY_USER,
+        password: process.env.MY_PASSWORD,
+        database: process.env.MY_DATABASE,
+        insecureAuth : true
+    });
+}
+  
+let con = createMySQLConnection();
+con.connect(function(err) {
+	if (err) throw err;
+	con.query(`SELECT * FROM subdomain_properties WHERE SubDomain = '${subdomain}'`, function (err, results) {
+		if (err) throw err;
+		// con.end();
+		if(results.length > 0){
+			let managed_domain = {};
+			for(let i=0; i < results.length; i++){
+				//console.log(results[i].SubDomain + " : " + results[i].PropertyName + " : " + results[i].PropertyValue);
+				managed_domain[results[i].PropertyName] = results[i].PropertyValue;
+			}
+
+			con.query(`SELECT * FROM configurations WHERE category="processors"`, function (err1, results1) {
+				if (err1) throw err1;
+				con.end();
+				if(results1.length > 0){
+					let processors = [];
+					for(let n=0; n < results1.length; n++){
+                        let processor = results1[n];
+						processor.json = JSON.parse(decode(processor.json));
+                        if(processor.json.processor=="paypal"){
+                            processors.push(processor);
+                        }
+					}
+					run(managed_domain, processors);
+				}else{
+                    console.log(`No active server for subdomain ${subdomain}`);
+                }
+
+			});   
+		}else{
+			console.log(`Error starting server! No port number found for subdomain ${subdomain}`);
+		}
+	});
+});  
+
+
+
+
+function run(managed_domain, processors){
+// function run(opts,opts1){
+	// console.log(typeof opts1[0].json);
+	// console.log(opts1[0].json.port);  
+
+	let active_paypal = null;
+	for(let n=0; n < processors.length; n++){
+		if(processors[n].json.active==true){
+			active_paypal = processors[n];
+			break;
+		}
+	}
+
+	console.log(active_paypal);
+
+	if(active_paypal==null){
+		console.log("No active paypal service");
+		return;
+	}
+	console.log("Starting Paypal Server on port: " + active_paypal.json.service_port);
+
+	var privateKey  = fs.readFileSync(managed_domain.CertPrivateKeyLocation, 'utf8');
+	var certificate = fs.readFileSync(managed_domain.CertPublicKeyLocation, 'utf8');
+
+	var credentials = {key: privateKey, cert: certificate};
+	var app = express();
+
+	// var clientId = process.env.CLIENT_ID;
+	let clientId = active_paypal.json.client_id;
+	let clientSecret = active_paypal.json.client_secret;
+	let base = "";
+	let mode = active_paypal.json.mode; 
+	if(mode=="sandbox"){
+		base = "https://api-m.sandbox.paypal.com"; 
+	}else{
+		base = "https://api-m.paypal.com"; 
+	}
+
+	// purchase service
+	app.get("/"+active_paypal.json.service_end_point, async (req, res) => {
+
+		console.log(base);
+	
+		try {
+			//console.log("starting...");
+			if(req.query.type=="check"){
+				const clientToken = await paypal.generateClientToken(base, clientId, clientSecret);
+				res.jsonp({action:true, token:clientToken, base:base});
+			}else if(req.query.type=="generate_token"){
+				console.log("Generating token...");
+				const clientToken = await paypal.generateClientToken(base, clientId, clientSecret);
+				res.jsonp(JSON.stringify({clientToken:clientToken,clientId:clientId}));
+			}else if(req.query.type=="create_order"){
+				console.log(req.query.data)
+				var data = JSON.parse( req.query.data );
+				const order = await paypal.createOrder(base, data, clientId, clientSecret);
+				res.jsonp(order);
+			}else if(req.query.type=="capture_order"){
+				const orderID = req.query.orderID;
+				const captureData = await paypal.capturePayment(base, orderID, clientId, clientSecret);
+				res.jsonp(captureData);
+			}else if(req.query.type=="refund"){
+				const orderID = req.query.orderID;
+				const captureData = await paypal.refundPayment(base, clientId, clientSecret, orderID);
+				res.jsonp(captureData);
+			}else if(req.query.type=="payout"){ 
+				// var data = JSON.parse( req.query.data );
+				const captureData = await paypal.payout(base, clientId, clientSecret, data);
+				res.jsonp(captureData);
+			}else if(req.query.type=="get_product_plan"){
+				var data = JSON.parse( req.query.data );
+				const captureData = await get_product_plan(base,clientId,clientSecret,data);
+				res.jsonp(captureData);
+			}
+		} catch (err) {
+
+
+			console.log(err.message)
+			res.jsonp(JSON.stringify({
+				err: err.message,
+				clientId: clientId,
+				clientSecret: clientSecret,
+				active_paypal: active_paypal
+			}));
+		}
+	});  
+
+	app.get("/check", async (req, res) => {
+		try {
+			if(req.query.type=="generate_token"){
+				console.log("Generating token...");
+				const clientToken = await paypal.generateClientToken(base, clientId, clientSecret);
+				res.jsonp(JSON.stringify({clientToken:clientToken,clientId:clientId}));
+			}
+		} catch (err) {
+			console.log(err.message)
+			res.jsonp(err.message);
+		}
+	});
+
+	// webhooks
+	app.get("/webhook_events_listener", async (req, res) => {
+
+		const accessToken = await paypal.generateAccessToken(base, clientId,clientSecret);
+
+		/*
+		"transmission_id": "69cd13f0-d67a-11e5-baa3-778b53f4ae55", 
+		"transmission_time": "2016-02-18T20:01:35Z", 
+		"cert_url": "cert_url",       // PAYPAL-CERT-URL
+		"auth_algo": "SHA256withRSA", // PAYPAL-AUTH-ALGO
+		*/
+
+		console.log("=========================")
+
+		let data = {
+			webhook_id: "",// The ID of the webhook as configured in your Developer Portal account.
+			transmission_id: req.get('PAYPAL-TRANSMISSION-ID'),
+			transmission_time: req.get('PAYPAL-TRANSMISSION-TIME'),
+			transmission_sig: req.get('PAYPAL-TRANSMISSION-SIG'),
+
+			cert_url: req.get('PAYPAL-CERT-URL'),
+			auth_algo: req.get('PAYPAL-AUTH-ALGO'),
+		}
+
+		// let fileloc = "/home/cradle2careertxorg/websites/www15/portal/admin/services/paypal/node/advanced-integration";
+		// fs.writeFile(fileloc + "/test", JSON.stringify(data, null, 4), function(err) {
+		// 	if(err) {
+		// 		return JSON.stringify(err, null, 4);
+		// 	}
+			
+		// }); 
+
+		// Aa-hUI-QfmPnt7vNwhqkoSdjE0UuK0wFe-neDJiuIfnOEXhGl-Fx8Qf1hxaDqxsw_JS5ta6ew2boAoTR
+		// EBaL2WenKH5x028AK_WukCFOzvwRaOtIgTgVSlN44xBRwKcvCYYr0cT4JOTDQK1CVlaJ-QM_b-d_bMYu
+
+		// console.log(accessToken);
+		
+
+		res.send(accessToken);
+		
+
+		// let response = await paypal.verifyWebHook(base);
+
+		
+
+	});
+
+	// var httpServer = http.createServer(app);
+	var httpsServer = https.createServer(credentials, app);
+
+	//httpServer.listen(9888);
+	httpsServer.listen(active_paypal.json.service_port);
+}
+
+// pm2 delete www15;pm2 start server.js --name "www15" -- www15;pm2 log --lines 200 www15
+
+
+
+/*
+curl -v POST https://api.sandbox.paypal.com/v1/oauth2/token \
+  -H "Accept: application/json" \
+  -H "Accept-Language: en_US" \
+  -u "AbehsBM-Cg5UwIx6pAWObkiltltLPwN82QlhN-u4qwYMD7Fzly_mDmUGYnSJqHuMLIWjhBk9I5iKsvIN:EIMOBpKnMGNlgaofARDgpuigkvpoSilNUJQSXSmXhNRwxrVosOVp1DCpb7Ky2OfjX7rR0SqszgRMyg1-" \
+  -d "grant_type=client_credentials"
+
+
+*/
+
+
+
+
+
+
+
+
+

admin/services/paypal/node/advanced-integration/server2.js

@@ -0,0 +1,27 @@
+import { createRequire } from 'module';
+import path from 'path';
+import { fileURLToPath } from 'url';
+const require = createRequire(import.meta.url);
+const __filename = fileURLToPath(import.meta.url);
+const __dirname = path.dirname(__filename);
+
+const fs = require('fs');
+const mypath = path.join(__dirname, '../../../../../../../../system/db/.env');
+require('dotenv').config({ path: mypath })
+
+console.log(process.env.MY_USER);
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+

admin/services/paypal/node/advanced-integration/views/checkout.ejs

@@ -0,0 +1,101 @@
+<html>
+  <head>
+    <meta charset="utf-8" />
+    <meta name="viewport" content="width=device-width, initial-scale=1" />
+    <link
+      rel="stylesheet"
+      type="text/css"
+      href="https://www.paypalobjects.com/webstatic/en_US/developer/docs/css/cardfields.css"
+    />
+    <script
+      src="https://www.paypal.com/sdk/js?components=buttons,hosted-fields&client-id=<%= clientId %>"
+      data-client-token="<%= clientToken %>"
+    ></script>
+  </head>
+  <body>
+    <div id="paypal-button-container" class="paypal-button-container"></div>
+    <div class="card_container">
+      <form id="card-form">
+        <label for="card-number">Card Number</label>
+        <div id="card-number" class="card_field"></div>
+        <div style="display: flex; flex-direction: row;">
+          <div>
+            <label for="expiration-date">Expiration Date</label>
+            <div id="expiration-date" class="card_field"></div>
+          </div>
+          <div style="margin-left: 10px;">
+            <label for="cvv">CVV</label>
+            <div id="cvv" class="card_field"></div>
+          </div>
+        </div>
+        <label for="card-holder-name">Name on Card</label>
+        <input
+          type="text"
+          id="card-holder-name"
+          name="card-holder-name"
+          autocomplete="off"
+          placeholder="card holder name"
+        />
+        <div>
+          <label for="card-billing-address-street">Billing Address</label>
+          <input
+            type="text"
+            id="card-billing-address-street"
+            name="card-billing-address-street"
+            autocomplete="off"
+            placeholder="street address"
+          />
+        </div>
+        <div>
+          <label for="card-billing-address-unit">&nbsp;</label>
+          <input
+            type="text"
+            id="card-billing-address-unit"
+            name="card-billing-address-unit"
+            autocomplete="off"
+            placeholder="unit"
+          />
+        </div>
+        <div>
+          <input
+            type="text"
+            id="card-billing-address-city"
+            name="card-billing-address-city"
+            autocomplete="off"
+            placeholder="city"
+          />
+        </div>
+        <div>
+          <input
+            type="text"
+            id="card-billing-address-state"
+            name="card-billing-address-state"
+            autocomplete="off"
+            placeholder="state"
+          />
+        </div>
+        <div>
+          <input
+            type="text"
+            id="card-billing-address-zip"
+            name="card-billing-address-zip"
+            autocomplete="off"
+            placeholder="zip / postal code"
+          />
+        </div>
+        <div>
+          <input
+            type="text"
+            id="card-billing-address-country"
+            name="card-billing-address-country"
+            autocomplete="off"
+            placeholder="country code"
+          />
+        </div>
+        <br /><br />
+        <button value="submit" id="submit" class="btn">Pay</button>
+      </form>
+    </div>
+    <script src="app.js"></script>
+  </body>
+</html>